Introduction：Basic information about CAS 330-64-3|[3,5-di(propan-2-yl)phenyl] N-methylcarbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [3,5-di(propan-2-yl)phenyl] N-methylcarbamate |
|---|
| CAS Number | 330-64-3 | Molecular Weight | 235.32200 |
|---|
| Density | 0.997g/cm3 | Boiling Point | 297.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.8ºC |
|---|
Names
| Name | [3,5-di(propan-2-yl)phenyl] N-methylcarbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.997g/cm3 |
|---|
| Boiling Point | 297.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21NO2 |
|---|
| Molecular Weight | 235.32200 |
|---|
| Flash Point | 133.8ºC |
|---|
| Exact Mass | 235.15700 |
|---|
| PSA | 41.82000 |
|---|
| LogP | 3.85600 |
|---|
| Index of Refraction | 1.501 |
|---|
| InChIKey | CUTUCYVZTGGYDL-UHFFFAOYSA-N |
|---|
| SMILES | CNC(=O)Oc1cc(C(C)C)cc(C(C)C)c1 |
|---|
Synonyms
| 3,5-Diisopropylphenyl N-methylcarbamate |
| HRS 1422 |
| Caswell No. 356A |
| ENT 25,780 |
| 3,5-Diisopropylphenyl methylcarbamate |
| Hooker hrs-1422 |
| DRC 2823 |
