Introduction：Basic information about CAS 33017-91-3|2-(4-benzylpiperazin-1-yl)-1H-quinazolin-4-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-benzylpiperazin-1-yl)-1H-quinazolin-4-one |
|---|
| CAS Number | 33017-91-3 | Molecular Weight | 320.38800 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 484.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 246.7ºC |
|---|
Names
| Name | 2-(4-benzylpiperazin-1-yl)-1H-quinazolin-4-one |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 484.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H20N4O |
|---|
| Molecular Weight | 320.38800 |
|---|
| Flash Point | 246.7ºC |
|---|
| Exact Mass | 320.16400 |
|---|
| PSA | 52.49000 |
|---|
| LogP | 2.66050 |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | PNLNMKQYPUQOIC-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c(N2CCN(Cc3ccccc3)CC2)nc2ccccc12 |
|---|
