Introduction：Basic information about CAS 34531-26-5|2-ethylhexyl 3,4,5-trihydroxybenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-ethylhexyl 3,4,5-trihydroxybenzoate |
|---|
| CAS Number | 34531-26-5 | Molecular Weight | 282.33200 |
|---|
| Density | 1.183g/cm3 | Boiling Point | 476.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H22O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.4ºC |
|---|
Names
| Name | 2-ethylhexyl 3,4,5-trihydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.183g/cm3 |
|---|
| Boiling Point | 476.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H22O5 |
|---|
| Molecular Weight | 282.33200 |
|---|
| Flash Point | 174.4ºC |
|---|
| Exact Mass | 282.14700 |
|---|
| PSA | 86.99000 |
|---|
| LogP | 3.17660 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | MTPIQEWGULCIPM-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)COC(=O)c1cc(O)c(O)c(O)c1 |
|---|
Synonyms
| Benzoic acid,3,4,5-trihydroxy-,2-ethylhexyl ester |
| Gallic acid,2-ethylhexyl ester |
| EINECS 252-073-5 |
| 2-Ethylhexyl gallate |
| 3,4,5-Trihydroxybenzoic acid,2-ethylhexyl ester |
