Introduction：Basic information about CAS 346688-72-0|4-(3-(Methylsulfonyl)phenyl)piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(3-(Methylsulfonyl)phenyl)piperidine |
|---|
| CAS Number | 346688-72-0 | Molecular Weight | 239.33400 |
|---|
| Density | 1.148g/cm3 | Boiling Point | 425.343ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.04ºC |
|---|
Names
| Name | 4-(3-methylsulfonylphenyl)piperidine |
|---|
Chemical & Physical Properties
| Density | 1.148g/cm3 |
|---|
| Boiling Point | 425.343ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2S |
|---|
| Molecular Weight | 239.33400 |
|---|
| Flash Point | 211.04ºC |
|---|
| Exact Mass | 239.09800 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 2.96670 |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | BFFDEVPWGSZYSN-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cccc(C2CCNCC2)c1 |
|---|
