Introduction：Basic information about CAS 39568-99-5|3,6-bis(bromomethyl)-1,2,4,5-tetrabromobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,6-bis(bromomethyl)-1,2,4,5-tetrabromobenzene |
|---|
| CAS Number | 39568-99-5 | Molecular Weight | 579.54100 |
|---|
| Density | 2.718g/cm3 | Boiling Point | 487ºC at 760mmHg |
|---|
| Molecular Formula | C8H4Br6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.1ºC |
|---|
Names
| Name | 1,2,4,5-tetrabromo-3,6-bis(bromomethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.718g/cm3 |
|---|
| Boiling Point | 487ºC at 760mmHg |
|---|
| Molecular Formula | C8H4Br6 |
|---|
| Molecular Weight | 579.54100 |
|---|
| Flash Point | 239.1ºC |
|---|
| Exact Mass | 573.54100 |
|---|
| LogP | 6.52640 |
|---|
| Index of Refraction | 1.699 |
|---|
| InChIKey | OXPRYRDKGWKGSY-UHFFFAOYSA-N |
|---|
| SMILES | BrCc1c(Br)c(Br)c(CBr)c(Br)c1Br |
|---|
Safety Information
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene,1,2,4,5-tetrabromo-3,6-bis(bromomethyl) |
| 2,3,5,6-Tetrabromo-p-xylene-a,a'-dibromide |
| EINECS 254-521-5 |
| 1,2,4,5-tetrabromo-3,6-bis-bromomethyl-benzene |
| 1,4-Bis(bromomethyl)tetrabromobenzene |
| 2,3,5,6-tetrabromo-1,4-bis(bromomethyl)benzene |
| 1,4-bis(bromomethyl)-2,3,5,6-tetrabromobenzene |
| a,a'-2,3,5,6-Hexabromo-p-xylene |
| 3,6-Bis(bromomethyl)-1,2,4,5-tetrabromobenzene |
