Introduction:Basic information about CAS 3963-79-9|p-Amino-4,2′-azotoluene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Amino-4,2′-azotoluene |
|---|
| CAS Number | 3963-79-9 | Molecular Weight | 225.28900 |
|---|
| Density | 1.09g/cm3 | Boiling Point | 398ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.5ºC |
|---|
Names
| Name | 3-methyl-4-[(4-methylphenyl)diazenyl]aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.09g/cm3 |
|---|
| Boiling Point | 398ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15N3 |
|---|
| Molecular Weight | 225.28900 |
|---|
| Flash Point | 194.5ºC |
|---|
| Exact Mass | 225.12700 |
|---|
| PSA | 50.74000 |
|---|
| LogP | 4.88220 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | TUOGLTOIBJYIAO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(N=Nc2ccc(N)cc2C)cc1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Benzenamine,3-methyl-4-((4-methylphenyl)azo) |
| 4'-Amino-4-2'-azotoluene |
| 3-methyl-4-[(4-methylphenyl)azo]-benzenamine |
| 6-p-Toluolazo-3-amino-toluol |
| p-Toluol-azo-m-toluidin |
| m-Toluidine,4-(p-tolylazo) |
| 4-Amino-2,4'-dimethyl-azobenzol |
| 4-(p-Tolylazo)-m-toluidine |
| Benzenamine,3-methyl-4-((4-methylphenyl)azo)-(9CI) |
| 3-methyl-4-p-tolylazo-aniline |