Introduction：Basic information about CAS 61049-89-6|2,2'-[[3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)azo]phenyl]imino]biseth, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-[[3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)azo]phenyl]imino]bisethanol |
|---|
| CAS Number | 61049-89-6 | Molecular Weight | 383.46700 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 625ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21N5O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 331.8ºC |
|---|
Names
| Name | 2-[N-(2-hydroxyethyl)-3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl]anilino]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 625ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21N5O2S |
|---|
| Molecular Weight | 383.46700 |
|---|
| Flash Point | 331.8ºC |
|---|
| Exact Mass | 383.14200 |
|---|
| PSA | 122.44000 |
|---|
| LogP | 3.71990 |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | BCWCNVJFJHRIFZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N(CCO)CCO)ccc1N=Nc1nc(-c2ccccc2)ns1 |
|---|
Synonyms
| 2,2'-((3-Methyl-4-((3-phenyl-1,2,4-thiadiazol-5-yl)azo)phenyl)imino)bisethanol |
| 5-((4-(Bis(2-hydroxyethyl)amino)-2-methylphenyl)azo)-3-phenyl-1,2,4-thiadiazole |
| Ethanol,2,2'-((3-methyl-4-((3-phenyl-1,2,4-thiadiazol-5-yl)azo)phenyl)imino)bis |
| Ethanol,2,2'-((3-methyl-4-(2-(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl)phenyl)imino)bis |
| EINECS 262-571-4 |
