Introduction:Basic information about CAS 61252-00-4|Benzenepropanoic acid, 4-amino-β-oxo-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenepropanoic acid, 4-amino-β-oxo-, ethyl ester |
|---|
| CAS Number | 61252-00-4 | Molecular Weight | 207.22600 |
|---|
| Density | 1.175g/cm3 | Boiling Point | 357.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.3ºC |
|---|
Names
| Name | ethyl 3-(4-aminophenyl)-3-oxopropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.175g/cm3 |
|---|
| Boiling Point | 357.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO3 |
|---|
| Molecular Weight | 207.22600 |
|---|
| Flash Point | 175.3ºC |
|---|
| Exact Mass | 207.09000 |
|---|
| PSA | 69.39000 |
|---|
| LogP | 1.98590 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | WZNJZROGRIBUEH-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(=O)c1ccc(N)cc1 |
|---|
Synonyms
| p-Amino-benzoyl-essigsaeure-aethylester |
| <4-Amino-benzoyl>-essigsaeure-ethylester |
| ethyl 4-amino-benzoylacetate |
| 4-Amino-benzoylessigsaeure-aethylester |
| Benzenepropanoic acid, 4-amino-β-oxo-, ethyl ester |