Introduction:Basic information about CAS 393-77-1|2,6-dinitro-4-(trifluoromethyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-dinitro-4-(trifluoromethyl)phenol |
|---|
| CAS Number | 393-77-1 | Molecular Weight | 252.10400 |
|---|
| Density | 1.737 g/cm3 | Boiling Point | 227.3ºC at 760 mmHg |
|---|
| Molecular Formula | C7H3F3N2O5 | Melting Point | 47 °C |
|---|
| MSDS | / | Flash Point | 91.3ºC |
|---|
Names
| Name | 2,6-dinitro-4-(trifluoromethyl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.737 g/cm3 |
|---|
| Boiling Point | 227.3ºC at 760 mmHg |
|---|
| Melting Point | 47 °C |
|---|
| Molecular Formula | C7H3F3N2O5 |
|---|
| Molecular Weight | 252.10400 |
|---|
| Flash Point | 91.3ºC |
|---|
| Exact Mass | 251.99900 |
|---|
| PSA | 111.87000 |
|---|
| LogP | 3.27380 |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | FXZGYEWQIGIFMC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3224 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| T0512-0739 |
| MFCD00194260 |
| 2,6-dinitro-4-trifluoromethylphenol |
| α,α,α-Trifluoro-2,6-dinitro-p-cresol |
| 2,6-Dinitro-4-trifluormethyl-phenol |
| 2,6-Dinitro-4-(trifluoroMethyl)phenol |
| 3,5-Dinitro-4-hydroxy-benzotrifluorid |
| 4-Hydroxy-3,5-dinitrobenzotrifluoride |