Introduction:Basic information about CAS 13680-35-8|4,4'-Methandiylbis(2,6-diethylanilin), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Methandiylbis(2,6-diethylanilin) |
|---|
| CAS Number | 13680-35-8 | Molecular Weight | 310.476 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 463.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H30N2 | Melting Point | 88-90 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 281.0±26.8 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4,4'-Methylenebis(2,6-diethylaniline) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 463.5±40.0 °C at 760 mmHg |
|---|
| Melting Point | 88-90 °C(lit.) |
|---|
| Molecular Formula | C21H30N2 |
|---|
| Molecular Weight | 310.476 |
|---|
| Flash Point | 281.0±26.8 °C |
|---|
| Exact Mass | 310.240906 |
|---|
| PSA | 52.04000 |
|---|
| LogP | 5.61 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | NWIVYGKSHSJHEF-UHFFFAOYSA-N |
|---|
| SMILES | CCc1cc(Cc2cc(CC)c(N)c(CC)c2)cc(CC)c1N |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921590090 |
|---|
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Benzenamine, 4,4'-methylenebis[2,6-diethyl- |
| Benzenamine,4,4-methylenebis2,6-diethyl |
| 4,4'-methanediylbis(2,6-diethylaniline) |
| Bis(4-amino-3,5-diethylphenyl)methane |
| 4,4'-Methylenebis(2,6-diethylaniline) |
| 4,4'-Methandiylbis(2,6-diethylanilin) |
| 4,4‘-Methylenebis(2,6-diethylaniline) |
| MFCD00071552 |
| EINECS 237-185-4 |
| 4,4'-Diamino-3,3',5,5'-tetraethyldiphenylmethane |