Introduction:Basic information about CAS 31364-42-8|Cryptofix 221, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cryptofix 221 |
|---|
| CAS Number | 31364-42-8 | Molecular Weight | 332.436 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 465.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H32N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.7±24.5 °C |
|---|
Names
| Name | 4,7,13,16,21-pentaoxa-1,10-diazabicyclo[8.8.5]tricosane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 465.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H32N2O5 |
|---|
| Molecular Weight | 332.436 |
|---|
| Flash Point | 133.7±24.5 °C |
|---|
| Exact Mass | 332.231110 |
|---|
| PSA | 52.63000 |
|---|
| LogP | -1.20 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | HDLXPNDSLDLJHF-UHFFFAOYSA-N |
|---|
| SMILES | C1COCCN2CCOCCOCCN(CCO1)CCOCC2 |
|---|
Safety Information
| Safety Phrases | S23-S24/25 |
|---|
| WGK Germany | 3.0 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,2,1-Cryptand |
| Cryptand[2.2.1] |
| [2.2.1]Cryptand |
| 2,2,1-Cryptate |
| Kryptofix (2.2.1) |
| Kryptofix(R) 221 |
| 4,7,13,16,21-Pentaoxa-1,10-diazabicyclo(8.8.5)tricosane |
| Cryptofix 221 |
| EINECS 250-592-1 |
| Cryptating agent 221 |
| 4,7,13,16,21-pentaoxa-1,10-diazabicyclo-[8,8,5]-tricosane |
| MFCD00005108 |
| 4,7,13,16,21-Pentaoxa-1,10-diazabicyclo[8.8.5]tricosane |