Introduction:Basic information about CAS 16090-14-5|Perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulfonyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulfonyl fluoride |
|---|
| CAS Number | 16090-14-5 | Molecular Weight | 446.11500 |
|---|
| Density | 1.802 g/cm3 | Boiling Point | 216.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7F14O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.802 g/cm3 |
|---|
| Boiling Point | 216.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7F14O4S |
|---|
| Molecular Weight | 446.11500 |
|---|
| Exact Mass | 445.92900 |
|---|
| PSA | 60.98000 |
|---|
| LogP | 5.44130 |
|---|
| Vapour Pressure | 0.156mmHg at 25°C |
|---|
| Index of Refraction | 1.411 |
|---|
| InChIKey | KTCQQCLZUOZFEI-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 2810 |
|---|
Synonyms
| Perfluoro-3,6-dioxa-4-methyloct-7-enesulphonyl fluoride |
| Ethanesulfonyl fluoride,2-(1-(difluoro((trifluoroethenyl)oxy)methyl)-1,2,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoro |
| 1,1,2,2-Tetrafluoro-2-(1,2,2-trifluoro-1-(trifluoromethyl)-2-((trifluorovinyl)oxy)ethoxy)ethanesulphonyl fluoride |
| Perfluoro-[2-(2-fluorosulfonylethoxy)propyl vinyl ether] |
| 5-trifluoroethoxy-4-trifluoromethyl-3-oxa-1,1,2,2,4,5,5-heptafluorosulfonyl fluoride |
| 1,1,2,2-tetrafluoro-2-({1,1,1,2,3,3-hexafluoro-3-[(trifluorovinyl)oxy]-2-propanyl}oxy)ethanesulfonyl fluoride |
| perfluoro(4-methyl-3,6-dioxa-7-octene)sulfonyl fluoride |
| perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulphonyl fluoride |
| perfluoro(4-methyl-3,6-dioxaoct-7-ene)sulfonyl fluoride |