Introduction：Basic information about CAS 39917-38-9|1-acetyl-3-hydroxyadamantane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-acetyl-3-hydroxyadamantane |
|---|
| CAS Number | 39917-38-9 | Molecular Weight | 194.270 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 303.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.9±15.8 °C |
|---|
Names
| Name | 1-(3-hydroxy-1-adamantyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 303.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18O2 |
|---|
| Molecular Weight | 194.270 |
|---|
| Flash Point | 127.9±15.8 °C |
|---|
| Exact Mass | 194.130676 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 0.97 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | ISGGLYJERYAKTR-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C12CC3CC(CC(O)(C3)C1)C2 |
|---|
Safety Information
Customs
| HS Code | 2914400090 |
|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Ethanone, 1-(3-hydroxytricyclo[3.3.1.1]dec-1-yl)- |
| 1-(3-Hydroxy-adamantan-1-yl)-ethanone |
| 3-Acetyladamantan-1-ol |
| 1-hydroxy-3-acetyladamantane |
| 1-acetyl-3-hydroxyadamantane |
| 3-hydroxy-1-adamantanyl ketone |
| 3-hydroxy-1-adamantyl methyl ketone |
| Ethanone, 1-(3-hydroxytricyclo[3.3.1.1(3,7)]dec-1-yl)- |
| 1-(3-Hydroxyadamantan-1-yl)ethanone |
| 1-acetyl-3-adamantanol |
