Introduction：Basic information about CAS 619-10-3|2-Chloro-5-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-5-nitrophenol |
|---|
| CAS Number | 619-10-3 | Molecular Weight | 173.554 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 276.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4ClNO3 | Melting Point | 118-121°C |
|---|
| MSDS | / | Flash Point | 120.8±23.2 °C |
|---|
Names
| Name | 2-Chloro-5-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 276.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 118-121°C |
|---|
| Molecular Formula | C6H4ClNO3 |
|---|
| Molecular Weight | 173.554 |
|---|
| Flash Point | 120.8±23.2 °C |
|---|
| Exact Mass | 172.987976 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.54 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | BUMGQSCPTLELLS-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Cl)c(O)c1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 6-chloro-3-nitrophenol |
| 5-nitro-2-chlorophenol |
| EINECS 210-579-3 |
| 2-Chlor-5-nitrobenzolol |
| 2-Chloro-5-Nitrofenol |
| 2-Chlor-5-nitro-phenol |
| 4-chloro-3-hydroxynitrobenzene |
| MFCD01571825 |
| 2-Chloro-5-nitrophenol |
| 2-chloro-5-nitro-phenol |
| Phenol, 2-chloro-5-nitro- |
| 6-Chlor-3-nitro-1-hydroxy-benzol |
| chloro-4 nitro-2 phenol |
