Introduction:Basic information about CAS 61226-19-5|3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
|---|
| CAS Number | 61226-19-5 | Molecular Weight | 216.23600 |
|---|
| Density | / | Boiling Point | 387.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O2 | Melting Point | 202ºC |
|---|
| MSDS | / | Flash Point | 188.2ºC |
|---|
Names
| Name | 3,5-dimethyl-1-phenylpyrazole-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 387.7ºC at 760 mmHg |
|---|
| Melting Point | 202ºC |
|---|
| Molecular Formula | C12H12N2O2 |
|---|
| Molecular Weight | 216.23600 |
|---|
| Flash Point | 188.2ºC |
|---|
| Exact Mass | 216.09000 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 2.18730 |
|---|
| InChIKey | LPYTYYLNGJGJGW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3,5-Dimethyl-1-phenyl-1H-pyrazol-4-carbonsaeure |
| (3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)carboxylic acid |
| MFCD02656670 |
| 3,5-Dimethyl-1-phenyl-4-pyrazolcarbonsaeure |
| 1-Phenyl-3.5-dimethyl-pyrazol-carbonsaeure-(4) |
| 3,5-Dimethyl-1-Phenyl-1h-Pyrazole-4-CarboxylicAcid |