Introduction:Basic information about CAS 36401-55-5|5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Methyl-2-phenyl-2H-1,2,3-triazole-4-carbonyl chloride |
|---|
| CAS Number | 36401-55-5 | Molecular Weight | 221.64300 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 374.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClN3O | Melting Point | 104ºC |
|---|
| MSDS | / | Flash Point | 180.3ºC |
|---|
Names
| Name | 5-methyl-2-phenyltriazole-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 374.6ºC at 760mmHg |
|---|
| Melting Point | 104ºC |
|---|
| Molecular Formula | C10H8ClN3O |
|---|
| Molecular Weight | 221.64300 |
|---|
| Flash Point | 180.3ºC |
|---|
| Exact Mass | 221.03600 |
|---|
| PSA | 47.78000 |
|---|
| LogP | 1.95470 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | UJYBUZMRRLFXGM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)Cl |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-methyl-2-phenyl-1,2,3-triazole-4-carbonyl chloride |
| BB_SC-8685 |
| 5-methyl-2-phenyl-1,2,3-triazol-4-carbonyl chloride |
| 4-methyl-2-phenyl-1,2,3-triazole-5-carbonyl chloride |
| 5-methyl-2-phenyl-2H-1,2,3-triazole-4-carboxyl chloride |
| 5-methyl-2-phenyl-2H-[1,2,3]triazole-4-carbonyl chloride |