Introduction：Basic information about CAS 444080-03-9|3-[(3,5-dimethoxybenzoyl)amino]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(3,5-dimethoxybenzoyl)amino]benzoic acid |
|---|
| CAS Number | 444080-03-9 | Molecular Weight | 301.29400 |
|---|
| Density | 1.316g/cm3 | Boiling Point | 451.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227ºC |
|---|
Names
| Name | 3-[(3,5-dimethoxybenzoyl)amino]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.316g/cm3 |
|---|
| Boiling Point | 451.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15NO5 |
|---|
| Molecular Weight | 301.29400 |
|---|
| Flash Point | 227ºC |
|---|
| Exact Mass | 301.09500 |
|---|
| PSA | 84.86000 |
|---|
| LogP | 2.72730 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | HKECJAFPUIWIPE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)cc(C(=O)Nc2cccc(C(=O)O)c2)c1 |
|---|
Synonyms
| 3-(3,5-dimethoxybenzamido)benzoic acid |
| 3-[(3,5-dimethoxyphenyl)carbonylamino]benzoic acid |
