Introduction：Basic information about CAS 13301-60-5|N-[2-[[2-chloro-4-(methylsulphonyl)phenyl]azo]-5-(diethylamino)phenyl]acetamid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-[[2-chloro-4-(methylsulphonyl)phenyl]azo]-5-(diethylamino)phenyl]acetamide |
|---|
| CAS Number | 13301-60-5 | Molecular Weight | 422.92900 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 689.4ºC at 760mmHg |
|---|
| Molecular Formula | C19H23ClN4O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 370.8ºC |
|---|
Names
| Name | N-[2-[[2-chloro-4-(methylsulphonyl)phenyl]azo]-5-(diethylamino)phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 689.4ºC at 760mmHg |
|---|
| Molecular Formula | C19H23ClN4O3S |
|---|
| Molecular Weight | 422.92900 |
|---|
| Flash Point | 370.8ºC |
|---|
| Exact Mass | 422.11800 |
|---|
| PSA | 99.58000 |
|---|
| LogP | 6.11730 |
|---|
| Vapour Pressure | 7.38E-19mmHg at 25°C |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | NOSYDKSCDZTOKC-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc(N=Nc2ccc(S(C)(=O)=O)cc2Cl)c(NC(C)=O)c1 |
|---|
Synonyms
| Acetamide,N-[2-[[2-chloro-4-(methylsulfonyl) phenyl]azo]-5-(diethylamino)phenyl] |
| N-(2-{[2-chloro-4-(methylsulphonyl)phenyl]azo}-5-(diethylamino)phenyl)acetamide |
| Disperse Red 210 |
| N-[2-[[2-chloro-4-(methylsulfonyl)phenyl]azo]-5-(diethylamino)phenyl]-Acetamide acetamide,n-[2-[[2-chloro-4-(methylsulfonyl)phenyl]azo]-5-(diethylamino)phenyl |
| N-[2-[[2-Chloro-4-(methylsulfonyl)phenyl]azo]-5-(diethylamino)phenyl]acetamide |
| C.I.Disperse Red 210 |
