Introduction:Basic information about CAS 13378-91-1|2-ETHYL-3,5,6,8-TETRAHYDROXY-[1,4]NAPHTHOQUINONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-ETHYL-3,5,6,8-TETRAHYDROXY-[1,4]NAPHTHOQUINONE |
|---|
| CAS Number | 13378-91-1 | Molecular Weight | 250.20400 |
|---|
| Density | 1.686g/cm3 | Boiling Point | 541.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 295.2ºC |
|---|
Names
| Name | 6-ethyl-4,5,7,8-tetrahydroxynaphthalene-1,2-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.686g/cm3 |
|---|
| Boiling Point | 541.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O6 |
|---|
| Molecular Weight | 250.20400 |
|---|
| Flash Point | 295.2ºC |
|---|
| Exact Mass | 250.04800 |
|---|
| PSA | 115.06000 |
|---|
| LogP | 1.40450 |
|---|
| Vapour Pressure | 2.52E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.733 |
|---|
| InChIKey | XVZRDQGFJDGVRP-UHFFFAOYSA-N |
|---|
| SMILES | CCc1c(O)c(O)c2c(c1O)C(O)=CC(=O)C2=O |
|---|
Safety Information
Customs
| HS Code | 2914690090 |
|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,4-Naphthalenedione,2-ethyl-3,5,6,8-tetrahydroxy |
| 3-ethyl-2,7-dihydronaphthazarin |
| 2-ethyl-3,5,6,8-tetrahydroxy-[1,4]naphthoquinone |
| 1,4-Naphthoquinone,2-ethyl-3,5,6,8-tetrahydroxy-(8CI) |
| ethylmompain |
| 2-Aethyl-3,5,6,8-tetrahydroxy-[1,4]naphthochinon |
| 3-ethyl-2,5,7,8-tetrahydroxy-1,4-naphthoquinone |
| 3-ethyl-2,7-dihydroxy-1,4-naphthazarin |