Introduction：Basic information about CAS 31604-39-4|1H-Isoindole-1,3(2H)-dione,2-(4-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Isoindole-1,3(2H)-dione,2-(4-nitrophenyl)- |
|---|
| CAS Number | 31604-39-4 | Molecular Weight | 268.22400 |
|---|
| Density | 1.501g/cm3 | Boiling Point | 494.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.7ºC |
|---|
Names
| Name | 2-(4-nitrophenyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.501g/cm3 |
|---|
| Boiling Point | 494.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H8N2O4 |
|---|
| Molecular Weight | 268.22400 |
|---|
| Flash Point | 252.7ºC |
|---|
| Exact Mass | 268.04800 |
|---|
| PSA | 83.20000 |
|---|
| LogP | 2.98360 |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | PHBJJKVNDZUAGC-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(4-nitrophenyl)isoindoline-1,3-dione |
| 2-(4-nitrophenyl)-1H-isoindole-1,3(2H)-dione |
| 2-(4-NITRO-PHENYL)-ISOINDOLE-1,3-DIONE |
| 1H-Isoindole-1,3(2H)-dione,2-(4-nitrophenyl) |
| N-[4'-(nitrophenyl)]phthalimide |
| N-p-nitrophenylphthalimide |
| N-(p-nitrophenyl)phthalanilic acid |
