Introduction：Basic information about CAS 25569-97-5|thiophene-2-carboxylic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | thiophene-2-carboxylic anhydride |
|---|
| CAS Number | 25569-97-5 | Molecular Weight | 238.28300 |
|---|
| Density | 1.438g/cm3 | Boiling Point | 381.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H6O3S2 | Melting Point | 58-61°C |
|---|
| MSDS | / | Flash Point | 184.4ºC |
|---|
Names
| Name | thiophene-2-carbonyl thiophene-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.438g/cm3 |
|---|
| Boiling Point | 381.3ºC at 760mmHg |
|---|
| Melting Point | 58-61°C |
|---|
| Molecular Formula | C10H6O3S2 |
|---|
| Molecular Weight | 238.28300 |
|---|
| Flash Point | 184.4ºC |
|---|
| Exact Mass | 237.97600 |
|---|
| PSA | 99.85000 |
|---|
| LogP | 2.80680 |
|---|
| Vapour Pressure | 5.11E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | BKBCDDYQJQGMNX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OC(=O)c1cccs1)c1cccs1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
Synonyms
| MFCD00068089 |
| 2-Thiophenecarboxylicacid,1,1'-anhydride |
| thiophene-2-carboxylic anhydride |
| Thiophen-2-carbonsaeure-anhydrid |
| thiophene-2-carboxylic acid-anhydride |
