Introduction：Basic information about CAS 169037-24-5|5-Aminoisatoic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Aminoisatoic anhydride |
|---|
| CAS Number | 169037-24-5 | Molecular Weight | 178.14500 |
|---|
| Density | 1.501g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H6N2O3 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 5-Aminoisatoic anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.501g/cm3 |
|---|
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C8H6N2O3 |
|---|
| Molecular Weight | 178.14500 |
|---|
| Exact Mass | 178.03800 |
|---|
| PSA | 89.09000 |
|---|
| LogP | 0.64470 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | QEQDLBKVHJXPJA-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2[nH]c(=O)oc(=O)c2c1 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H317-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Amino-1H-benzo[d][1,3]oxazine-2,4-dione |
| 5-AMINOISATOIC ANHYDRIDE |
| MFCD00060534 |
