Introduction：Basic information about CAS 25784-91-2|2-Chloro-5-nitrobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-5-nitrobenzoyl chloride |
|---|
| CAS Number | 25784-91-2 | Molecular Weight | 220.010 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 307.9±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3Cl2NO3 | Melting Point | 58-60°C |
|---|
| MSDS | USA | Flash Point | 140.0±22.3 °C |
|---|
Names
| Name | 2-Chloro-5-nitrobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 307.9±22.0 °C at 760 mmHg |
|---|
| Melting Point | 58-60°C |
|---|
| Molecular Formula | C7H3Cl2NO3 |
|---|
| Molecular Weight | 220.010 |
|---|
| Flash Point | 140.0±22.3 °C |
|---|
| Exact Mass | 218.949005 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | OGLKKYALUKXVPQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])ccc1Cl |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | R34:Causes burns. |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00059180 |
| 2-Chloro-5-nitrobenzoyl chloride |
| Benzoyl chloride, 2-chloro-5-nitro- |
| 2-Chloro-5-nitrobenzoylchloride |
| EINECS 247-262-4 |
| 3-nitro-6-chloro-benzoylchloride |
| 2-Chlor-5-nitro-benzoylchlorid |
| Benzoyl chloride,2-chloro-5-nitro |
