Introduction：Basic information about CAS 618-98-4|Benzoic acid, 3-nitro-,ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid, 3-nitro-,ethyl ester |
|---|
| CAS Number | 618-98-4 | Molecular Weight | 195.17200 |
|---|
| Density | 1.253g/cm3 | Boiling Point | 297-298°C |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | 41 °C |
|---|
| MSDS | / | Flash Point | 297-298°C |
|---|
Names
| Name | ethyl 3-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.253g/cm3 |
|---|
| Boiling Point | 297-298°C |
|---|
| Melting Point | 41 °C |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.17200 |
|---|
| Flash Point | 297-298°C |
|---|
| Exact Mass | 195.05300 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.29470 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | MKBIJCPQTPFQKQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cccc([N+](=O)[O-])c1 |
|---|
| Stability | Stable. Incompatible with strong oxidizing agents. |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| ethyl-3-nitrobenzoate |
| m-nitro-carboethoxy-benzene |
| Ethyl-m-nitrobenzoate |
| EINECS 210-574-6 |
| MFCD00014702 |
| 3-Nitro-benzoesaeure-aethylester |
| Benzoic acid,3-nitro-,ethyl ester |
| m-Nitrobenzoic acid,ethyl ester |
| 3-nitro-benzoic acid ethyl ester |
