Introduction：Basic information about CAS 181258-97-9|Methyl 4-acetoxy-8-{[(trifluoromethyl)sulfonyl]oxy}-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-8-{[(trifluoromethyl)sulfonyl]oxy}-2-naphthoate |
|---|
| CAS Number | 181258-97-9 | Molecular Weight | 392.30400 |
|---|
| Density | 1.506g/cm3 | Boiling Point | 487.798ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11F3O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.812ºC |
|---|
Names
| Name | Methyl 4-acetoxy-8-{[(trifluoromethyl)sulfonyl]oxy}-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.506g/cm3 |
|---|
| Boiling Point | 487.798ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11F3O7S |
|---|
| Molecular Weight | 392.30400 |
|---|
| Flash Point | 248.812ºC |
|---|
| Exact Mass | 392.01800 |
|---|
| PSA | 104.35000 |
|---|
| LogP | 3.86090 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | DLHUTXJYJCAHES-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2cccc(OS(=O)(=O)C(F)(F)F)c2c1 |
|---|
