Introduction：Basic information about CAS 181258-98-0|Methyl 4-hydroxy-8-phenoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-hydroxy-8-phenoxy-2-naphthoate |
|---|
| CAS Number | 181258-98-0 | Molecular Weight | 294.30100 |
|---|
| Density | 1.277g/cm3 | Boiling Point | 495.152ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.948ºC |
|---|
Names
| Name | Methyl 4-hydroxy-8-phenoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.277g/cm3 |
|---|
| Boiling Point | 495.152ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14O4 |
|---|
| Molecular Weight | 294.30100 |
|---|
| Flash Point | 183.948ºC |
|---|
| Exact Mass | 294.08900 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 4.12430 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | BCUKASGJHOZHHN-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2cccc(Oc3ccccc3)c2c1 |
|---|
