Introduction：Basic information about CAS 181259-00-7|Methyl 8-phenoxy-4-{[(trifluoromethyl)sulfonyl]oxy}-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 8-phenoxy-4-{[(trifluoromethyl)sulfonyl]oxy}-2-naphthoate |
|---|
| CAS Number | 181259-00-7 | Molecular Weight | 426.36300 |
|---|
| Density | 1.453g/cm3 | Boiling Point | 521.032ºC at 760 mmHg |
|---|
| Molecular Formula | C19H13F3O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.911ºC |
|---|
Names
| Name | Methyl 8-phenoxy-4-{[(trifluoromethyl)sulfonyl]oxy}-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.453g/cm3 |
|---|
| Boiling Point | 521.032ºC at 760 mmHg |
|---|
| Molecular Formula | C19H13F3O6S |
|---|
| Molecular Weight | 426.36300 |
|---|
| Flash Point | 268.911ºC |
|---|
| Exact Mass | 426.03800 |
|---|
| PSA | 87.28000 |
|---|
| LogP | 5.72790 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | IMURCWIRCPJLKC-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OS(=O)(=O)C(F)(F)F)c2cccc(Oc3ccccc3)c2c1 |
|---|
