Introduction：Basic information about CAS 185310-19-4|Ethyl 4-acetoxy-8-bromo-5-isopropoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-8-bromo-5-isopropoxy-2-naphthoate |
|---|
| CAS Number | 185310-19-4 | Molecular Weight | 395.24400 |
|---|
| Density | 1.367g/cm3 | Boiling Point | 497.573ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19BrO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.723ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-8-bromo-5-isopropoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.367g/cm3 |
|---|
| Boiling Point | 497.573ºC at 760 mmHg |
|---|
| Molecular Formula | C18H19BrO5 |
|---|
| Molecular Weight | 395.24400 |
|---|
| Flash Point | 254.723ºC |
|---|
| Exact Mass | 394.04200 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 4.49150 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | SKHFNZKJOQEFER-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c(OC(C)C)ccc(Br)c2c1 |
|---|
