Introduction:Basic information about CAS 13741-18-9|4,5-dimethyl-2-[(1R,3R,4S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-dimethyl-2-[(1R,3R,4S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl]phenol |
|---|
| CAS Number | 13741-18-9 | Molecular Weight | 258.39800 |
|---|
| Density | 1.019g/cm3 | Boiling Point | 320.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H26O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144.2ºC |
|---|
Names
| Name | 4,5-dimethyl-2-[(1R,3R,4S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.019g/cm3 |
|---|
| Boiling Point | 320.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H26O |
|---|
| Molecular Weight | 258.39800 |
|---|
| Flash Point | 144.2ºC |
|---|
| Exact Mass | 258.19800 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 4.93880 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | RNRHMQWZFJXKLZ-JCKWVBRZSA-N |
|---|
| SMILES | Cc1cc(O)c(C2CC3CCC2(C)C3(C)C)cc1C |
|---|
Synonyms
| EINECS 237-312-3 |
| Xibornol |
| Xibornolum |
| Bactacine |
| Bracen |
| 6-Isobornyl-3,4-xylenol |
| Nanbacine |