Introduction:Basic information about CAS 18419-53-9|Diphenylvinylchlorosilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diphenylvinylchlorosilane |
|---|
| CAS Number | 18419-53-9 | Molecular Weight | 244.792 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 303.7±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H13ClSi | Melting Point | <0ºC |
|---|
| MSDS | / | Flash Point | 126.7±10.3 °C |
|---|
Names
| Name | chloro-ethenyl-diphenylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 303.7±15.0 °C at 760 mmHg |
|---|
| Melting Point | <0ºC |
|---|
| Molecular Formula | C14H13ClSi |
|---|
| Molecular Weight | 244.792 |
|---|
| Flash Point | 126.7±10.3 °C |
|---|
| Exact Mass | 244.047501 |
|---|
| LogP | 6.28 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | PLMTWHZZBPGADP-UHFFFAOYSA-N |
|---|
| SMILES | C=C[Si](Cl)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39-45-27-22 |
|---|
| RIDADR | UN 2987 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Diphenylvinylchlorosilane |
| Silane,chlorodiphenylvinyl |
| Vinyldiphenylchlorosilane |
| Silane,chloroethenyldiphenyl |
| Chloro(diphenyl)vinylsilane |
| Ph2(vinyl)SiCl |
| chlorodiphenyl(vinyl)silane |
| Silane, chlorodiphenylvinyl- |
| diphenylvinylsilyl chloride |
| chloranyl-ethenyl-diphenyl-silane |
| Silane, chloroethenyldiphenyl- |
| Benzene, 1,1'-(chloroethenylsilylene)bis- |