Introduction:Basic information about CAS 3139-05-7|2,5-dimethyl-4-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dimethyl-4-nitrophenol |
|---|
| CAS Number | 3139-05-7 | Molecular Weight | 166.17700 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 342.5ºC at 760mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | 134-136ºC |
|---|
| MSDS | / | Flash Point | 160.9ºC |
|---|
Names
| Name | 2,5-dimethyl-4-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 342.5ºC at 760mmHg |
|---|
| Melting Point | 134-136ºC |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.17700 |
|---|
| Flash Point | 160.9ºC |
|---|
| Exact Mass | 166.07400 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 2.89820 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | DSWZKAODNLLINU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,5-Dimethyl-4-nitro-phenol |
| 2,4-DIMETHYLBENZOTRIFLUORIDE |
| 2,5-dimethyl-4-hydroxynitrobenzene |
| 2,5-Dimethyl-4-nitrophenol |
| Phenol,2,5-dimethyl-4-nitro |
| 2,5-Dimethyl-4-nitroaniline |
| 5-Nitro-2-hydroxy-p-xylol |
| 2-Hydroxy-5-nitro 1,4-xylene |
| 5-Nitro-2-oxy-1.4-dimethyl-benzol |
| 4-Nitro-2,5-xylenol |
| 4-Nitro-p-xylenol |