Introduction：Basic information about CAS 6161-23-5|3′, 5′-Di-O-acetyl-5-bromo-2′-deoxyuridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3′, 5′-Di-O-acetyl-5-bromo-2′-deoxyuridine |
|---|
| CAS Number | 6161-23-5 | Molecular Weight | 391.17100 |
|---|
| Density | 1.667g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H15BrN2O7 | Melting Point | 148-150ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3',5'-di-o-acetyl-5-bromo-2'-deoxy-d-uridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.667g/cm3 |
|---|
| Melting Point | 148-150ºC |
|---|
| Molecular Formula | C13H15BrN2O7 |
|---|
| Molecular Weight | 391.17100 |
|---|
| Exact Mass | 390.00600 |
|---|
| PSA | 116.69000 |
|---|
| LogP | 0.08140 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | QRIHCNASFWJWJB-HBNTYKKESA-N |
|---|
| SMILES | CC(=O)OCC1OC(n2cc(Br)c(=O)[nH]c2=O)CC1OC(C)=O |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 5-BroMo-2'-deoxy-uridine 3',5'-Diacetate |
| 3',5'-di-O-acetyl-2'-deoxy-5-bromouridine |
| O3',O5'-diacetyl-5-bromo-2'-deoxy-uridine |
| 5-bromo-3',5'-di-O-acetyl-2'-deoxyuridine |
| 3',5'-diacetyl-5-bromo-N4-2'-deoxyuridine |
| 3',5'-Di-O-acetyl-5-brom-2'-deoxyuridin |
| 3',5'-diacetyl-5-bromo-2'-deoxyuridine |
