Introduction:Basic information about CAS 493-75-4|bialamicol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bialamicol |
|---|
| CAS Number | 493-75-4 | Molecular Weight | 436.62900 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 506.6ºC at 760 mmHg |
|---|
| Molecular Formula | C28H40N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.6ºC |
|---|
Names
| Name | bialamicol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 506.6ºC at 760 mmHg |
|---|
| Molecular Formula | C28H40N2O2 |
|---|
| Molecular Weight | 436.62900 |
|---|
| Flash Point | 206.6ºC |
|---|
| Exact Mass | 436.30900 |
|---|
| PSA | 46.94000 |
|---|
| LogP | 5.90540 |
|---|
| Vapour Pressure | 6.95E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | DQNIWUUHJSXGHW-UHFFFAOYSA-N |
|---|
| SMILES | C=CCc1cc(-c2cc(CC=C)c(O)c(CN(CC)CC)c2)cc(CN(CC)CC)c1O |
|---|
Synonyms
| 3,3'-Diallyl-5,5'-bis-diaethylaminomethyl-biphenyl-4,4'-diol |
| 5,5'-Diallyl-3,3'-bis[(diethylamino)methyl]-4,4'-dihydroxybiphenyl |
| 5,5'-Bis(diethylaminomethyl)-3,3'-diallyl-1,1'-biphenyl-4,4'-diol |
| 2-(diethylaminomethyl)-4-[3-(diethylaminomethyl)-4-hydroxy-5-prop-2-enylphenyl]-6-prop-2-enylphenol |
| 2-allyl-4-[3-allyl-5-(diethylaminomethyl)-4-hydroxy-phenyl]-6-(diethylaminomethyl)phenol |
| 3,3-diallyl-5,5-bis(diethylaminomethyl)biphenyl-4,4-diol |