Introduction：Basic information about CAS 64795-23-9|Etisulergine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Etisulergine |
|---|
| CAS Number | 64795-23-9 | Molecular Weight | 376.51600 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 561.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H28N4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 293.4ºC |
|---|
Names
| Name | Etisulergine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 561.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H28N4O2S |
|---|
| Molecular Weight | 376.51600 |
|---|
| Flash Point | 293.4ºC |
|---|
| Exact Mass | 376.19300 |
|---|
| PSA | 76.82000 |
|---|
| LogP | 3.46610 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | YHEIHLVIKSTGJE-YXJHDRRASA-N |
|---|
| SMILES | CCN(CC)S(=O)(=O)NC1CC2c3cccc4[nH]cc(c34)CC2N(C)C1 |
|---|
Synonyms
| 2,7,12,18-Tetraaethyl-3,8,13,17-tetramethyl-porphyrin |
| Etioporphyrin 3 |
| N,N-diethyl-N'-(6-methyl-ergolin-8-yl)-sulfamide |
| 2,7,12,18-tetraethyl-3,8,13,17-tetramethyl-porphyrin |
| aetioporphyrin-III |
| 3,8,13,17-tetraethyl-2,7,12,18-tetramethylporphyrin |
| 2,7,12,18-Tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphyrin |
| 2,7,12,18-tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphine |
