Introduction:Basic information about CAS 97944-83-7|Methyl 5-acetoxy-4,6,7-trimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 5-acetoxy-4,6,7-trimethoxy-2-naphthoate |
|---|
| CAS Number | 97944-83-7 | Molecular Weight | 334.32100 |
|---|
| Density | 1.233g/cm3 | Boiling Point | 452.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.3ºC |
|---|
Names
| Name | Methyl 5-acetoxy-4,6,7-trimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.233g/cm3 |
|---|
| Boiling Point | 452.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18O7 |
|---|
| Molecular Weight | 334.32100 |
|---|
| Flash Point | 199.3ºC |
|---|
| Exact Mass | 334.10500 |
|---|
| PSA | 80.29000 |
|---|
| LogP | 2.57750 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | QDJQUEVFTUMTHY-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2c(OC(C)=O)c(OC)c(OC)cc2c1 |
|---|