Introduction:Basic information about CAS 97944-84-8|Methyl 5-acetoxy-7-bromo-4,8-dimethoxy-6-methyl-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 5-acetoxy-7-bromo-4,8-dimethoxy-6-methyl-2-naphthoate |
|---|
| CAS Number | 97944-84-8 | Molecular Weight | 397.21700 |
|---|
| Density | 1.421g/cm3 | Boiling Point | 506.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17BrO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 260.1ºC |
|---|
Names
| Name | Methyl 5-acetoxy-7-bromo-4,8-dimethoxy-6-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.421g/cm3 |
|---|
| Boiling Point | 506.5ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17BrO6 |
|---|
| Molecular Weight | 397.21700 |
|---|
| Flash Point | 260.1ºC |
|---|
| Exact Mass | 396.02100 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 3.63980 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | GRGWLNSJHBBYGR-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2c(OC(C)=O)c(C)c(Br)c(OC)c2c1 |
|---|