Introduction:Basic information about CAS 97944-86-0|Methyl 4,5-diacetoxy-8-methoxy-6-methyl-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4,5-diacetoxy-8-methoxy-6-methyl-2-naphthoate |
|---|
| CAS Number | 97944-86-0 | Molecular Weight | 346.33100 |
|---|
| Density | 1.25g/cm3 | Boiling Point | 505.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223ºC |
|---|
Names
| Name | Methyl 4,5-diacetoxy-8-methoxy-6-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.25g/cm3 |
|---|
| Boiling Point | 505.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O7 |
|---|
| Molecular Weight | 346.33100 |
|---|
| Flash Point | 223ºC |
|---|
| Exact Mass | 346.10500 |
|---|
| PSA | 88.13000 |
|---|
| LogP | 2.79400 |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | VEHPIQIWJDUYCO-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2c(OC(C)=O)c(C)cc(OC)c2c1 |
|---|