Introduction：Basic information about CAS 133593-68-7|Methyl 4-acetoxy-7-bromo-8-methoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-7-bromo-8-methoxy-2-naphthoate |
|---|
| CAS Number | 133593-68-7 | Molecular Weight | 353.16500 |
|---|
| Density | 1.476g/cm3 | Boiling Point | 468.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 237.3ºC |
|---|
Names
| Name | Methyl 4-acetoxy-7-bromo-8-methoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.476g/cm3 |
|---|
| Boiling Point | 468.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H13BrO5 |
|---|
| Molecular Weight | 353.16500 |
|---|
| Flash Point | 237.3ºC |
|---|
| Exact Mass | 351.99500 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 3.32280 |
|---|
| Vapour Pressure | 5.8E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | ACCKXDRGUCNXSZ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2ccc(Br)c(OC)c2c1 |
|---|
