Introduction：Basic information about CAS 166978-49-0|4-[2-(5,6,7,8-Tetrahydro-5,5-dimethyl-8-oxo-2-naphthalenyl)ethynyl]benzoic Ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(5,6,7,8-Tetrahydro-5,5-dimethyl-8-oxo-2-naphthalenyl)ethynyl]benzoic Acid Ethyl Ester |
|---|
| CAS Number | 166978-49-0 | Molecular Weight | 346.41900 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 506.8ºC at 760mmHg |
|---|
| Molecular Formula | C23H22O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.2ºC |
|---|
Names
| Name | ethyl 4-[2-(5,5-dimethyl-8-oxo-6,7-dihydronaphthalen-2-yl)ethynyl]benzoate |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 506.8ºC at 760mmHg |
|---|
| Molecular Formula | C23H22O3 |
|---|
| Molecular Weight | 346.41900 |
|---|
| Flash Point | 221.2ºC |
|---|
| Exact Mass | 346.15700 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 4.51720 |
|---|
| Vapour Pressure | 2.15E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | HKLPOHJGESDTSC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(C#Cc2ccc3c(c2)C(=O)CCC3(C)C)cc1 |
|---|
