Introduction:Basic information about CAS 3383-72-0|β-Chloro-4-nitrophenethole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | β-Chloro-4-nitrophenethole |
|---|
| CAS Number | 3383-72-0 | Molecular Weight | 201.607 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 332.1±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO3 | Melting Point | 57-66°C |
|---|
| MSDS | / | Flash Point | 154.6±20.9 °C |
|---|
Names
| Name | 1-(2-Chloroethoxy)-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 332.1±17.0 °C at 760 mmHg |
|---|
| Melting Point | 57-66°C |
|---|
| Molecular Formula | C8H8ClNO3 |
|---|
| Molecular Weight | 201.607 |
|---|
| Flash Point | 154.6±20.9 °C |
|---|
| Exact Mass | 201.019272 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.49 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | OBCFOPGCTNULTG-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OCCCl)cc1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-nitro-(2-chloroethoxy)benzene |
| 2-Chloroethyl4-nitrophenylether |
| 2-Chloroethyl 4-nitrophenyl ether |
| BETA-CHLORO-4-NITROPHENETHOLE |
| MFCD00674505 |
| (2-chloro-ethyl)-(4-nitro-phenyl)-ether |
| 4-Nitrophenyl 2-chloroethyl ether |
| 2-(4-nitrophenoxy)ethyl chloride |
| Benzene, 1-(2-chloroethoxy)-4-nitro- |
| WNR DO2G |
| chloroethoxynitrobenzene |
| 1-(2-Chloroethoxy)-4-nitrobenzene |
| β-Chloro-4-nitrophenethole |
| 4-(2'-chloroethoxy)-nitrobenzene |
| EINECS 425-790-8 |