Introduction：Basic information about CAS 132717-37-4|2,7-Dibromo-9-phenyl-9H-fluoren-9-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol |
|---|
| CAS Number | 132717-37-4 | Molecular Weight | 416.106 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 526.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H12Br2O | Melting Point | 165 °C |
|---|
| MSDS | / | Flash Point | 272.1±30.1 °C |
|---|
Names
| Name | 2,7-dibromo-9-phenylfluoren-9-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 526.4±50.0 °C at 760 mmHg |
|---|
| Melting Point | 165 °C |
|---|
| Molecular Formula | C19H12Br2O |
|---|
| Molecular Weight | 416.106 |
|---|
| Flash Point | 272.1±30.1 °C |
|---|
| Exact Mass | 413.925476 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 5.38 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.722 |
|---|
| InChIKey | VGZUBRZNTWOSTO-UHFFFAOYSA-N |
|---|
| SMILES | OC1(c2ccccc2)c2cc(Br)ccc2-c2ccc(Br)cc21 |
|---|
Synonyms
| 2,7-dibromo-9-phenyl-9-fluorenol |
| 2,7-dibromo-9-phenyl-fluoren-9-ol |
| 9H-Fluoren-9-ol, 2,7-dibromo-9-phenyl- |
| 2,7-dibromo-(9-phenyl-9H-fluoren-9-ol) |
| 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol |
| 2,5-DIMETHYL-7-THIA-2,5-DIAZABICYCLO[2.2.1]HEPTANES-3,6-DIONE |
| AC-5815 |
