Introduction：Basic information about CAS 25827-76-3|iomeglamic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | iomeglamic acid |
|---|
| CAS Number | 25827-76-3 | Molecular Weight | 613.95700 |
|---|
| Density | 2.42g/cm3 | Boiling Point | 665.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H13I3N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 356.1ºC |
|---|
Names
| Name | 5-(3-amino-2,4,6-triiodo-N-methylanilino)-5-oxopentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.42g/cm3 |
|---|
| Boiling Point | 665.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H13I3N2O3 |
|---|
| Molecular Weight | 613.95700 |
|---|
| Flash Point | 356.1ºC |
|---|
| Exact Mass | 613.80600 |
|---|
| PSA | 83.63000 |
|---|
| LogP | 3.88150 |
|---|
| Vapour Pressure | 1.34E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.752 |
|---|
| InChIKey | QIFJTEYRIMDFPK-UHFFFAOYSA-N |
|---|
| SMILES | CN(C(=O)CCCC(=O)O)c1c(I)cc(I)c(N)c1I |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Iomeglamic acid |
| Falignost |
| RG 270 |
| Iomeglamsaeure |
| 3'-Amino-2',4',6'-triiodo-N-methylglutaranilic acid |
| Iomeglamis acid |
| Acido iomeglamico [Spanish] |
| Acidum iomeglamicum [Latin] |
| Iomeglamsaeure [German] |
| Falignost (R) |
| Acide iomeglamique [French] |
