Introduction：Basic information about CAS 316146-27-7|n-(4-bromphenyl)-3-phenylpropanamid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(4-bromphenyl)-3-phenylpropanamid |
|---|
| CAS Number | 316146-27-7 | Molecular Weight | 304.182 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 473.2±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14BrNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.0±26.8 °C |
|---|
Names
| Name | N-(4-bromophenyl)-3-phenylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 473.2±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14BrNO |
|---|
| Molecular Weight | 304.182 |
|---|
| Flash Point | 240.0±26.8 °C |
|---|
| Exact Mass | 303.025879 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 4.48 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | HGPWLPIFXDCULJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCc1ccccc1)Nc1ccc(Br)cc1 |
|---|
Synonyms
| N-(4-Bromophenyl)-3-phenylpropanamide |
| Benzenepropanamide, N-(4-bromophenyl)- |
| intermediate compound 1 |
| Propanamide,N-(4-bromophenyl)-3-phenyl |
| n-(4-bromphenyl)-3-phenylpropanamid |
| N-(4-bromo-phenyl)-3-phenyl propionamide |
