Introduction:Basic information about CAS 16013-44-8|4-[(5-chloro-4-methyl-2-sulphophenyl)azo]-3-hydroxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(5-chloro-4-methyl-2-sulphophenyl)azo]-3-hydroxy-2-naphthoic acid |
|---|
| CAS Number | 16013-44-8 | Molecular Weight | 420.82400 |
|---|
| Density | 1.59g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C18H13ClN2O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[(5-chloro-4-methyl-2-sulfophenyl)hydrazinylidene]-3-oxonaphthalene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Molecular Formula | C18H13ClN2O6S |
|---|
| Molecular Weight | 420.82400 |
|---|
| Exact Mass | 420.01800 |
|---|
| PSA | 141.51000 |
|---|
| LogP | 3.91580 |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | LZNMMJSXOXXHFD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(S(=O)(=O)O)c(N=Nc2c(O)c(C(=O)O)cc3ccccc23)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (3-Chlor-4-methyl-6-sulfo-benzol)-(1-azo-1)-naphthol-(2)-3-carbonsaeure |
| EINECS 240-150-6 |
| 1-(2-sulfo-4-methyl-5-chloro-1-phenylazo)-2-hydroxynaphthalene-3-carboxylic acid |
| 4-[(5-chloro-4-methyl-2-sulfophenyl)azo]-3-hydroxy-2-naphthoic acid |
| 4-((5-Chloro-4-methyl-2-sulphophenyl)azo)-3-hydroxy-2-naphthoic acid |
| 2-Naphthalenecarboxylic acid,4-((5-chloro-4-methyl-2-sulfophenyl)azo)-3-hydroxy |
| 1-(2-sulpho-4-methyl-5-chloro-1-phenylazo)-2-hydroxy-naphthalene-3-carboxylic acid |
| 2-Naphthalenecarboxylic acid,4-(2-(5-chloro-4-methyl-2-sulfophenyl)diazenyl)-3-hydroxy |