Introduction：Basic information about CAS 137-65-5|2-Amino-5-(aminosulphonyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-5-(aminosulphonyl)benzoic acid |
|---|
| CAS Number | 137-65-5 | Molecular Weight | 216.21400 |
|---|
| Density | 1.623 g/cm3 | Boiling Point | 518.7ºC at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O4S | Melting Point | 113-114 °C(lit.) |
|---|
| MSDS | / | Flash Point | 267.5ºC |
|---|
Names
| Name | 2-amino-5-sulfamoylbenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.623 g/cm3 |
|---|
| Boiling Point | 518.7ºC at 760 mmHg |
|---|
| Melting Point | 113-114 °C(lit.) |
|---|
| Molecular Formula | C7H8N2O4S |
|---|
| Molecular Weight | 216.21400 |
|---|
| Flash Point | 267.5ºC |
|---|
| Exact Mass | 216.02000 |
|---|
| PSA | 131.86000 |
|---|
| LogP | 1.97670 |
|---|
| Vapour Pressure | 1.38E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | JRGAUAWPCLQHTF-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(S(N)(=O)=O)cc1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22:Harmful if swallowed. |
|---|
| Safety Phrases | S36/37/39-S26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| EINECS 205-304-9 |
| 5-sulfamoylanthranilic acid |
| 2-amino-5-sulfamoyl-benzoic acid |
| 5-Sulfamoyl-anthranilsaeure |
| 2-Amino-5-sulfamoyl-benzoesaeure |
| MFCD00036104 |
| 2-Amino benzoic acid-5-sulfonamide |
