Introduction：Basic information about CAS 163520-33-0|isoxadifen-ethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | isoxadifen-ethyl |
|---|
| CAS Number | 163520-33-0 | Molecular Weight | 295.332 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H17NO3 | Melting Point | 87-88℃ (ethyl ether ) |
|---|
| MSDS | ChineseUSA | Flash Point | 166.8±25.9 °C |
|---|
| Symbol |
GHS07, GHS09 | Signal Word | Warning |
|---|
Names
| Name | isoxadifen-ethyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 407.7±55.0 °C at 760 mmHg |
|---|
| Melting Point | 87-88℃ (ethyl ether ) |
|---|
| Molecular Formula | C18H17NO3 |
|---|
| Molecular Weight | 295.332 |
|---|
| Flash Point | 166.8±25.9 °C |
|---|
| Exact Mass | 295.120850 |
|---|
| PSA | 47.89000 |
|---|
| LogP | 3.10 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | MWKVXOJATACCCH-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1=NOC(c2ccccc2)(c2ccccc2)C1 |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol |
GHS07, GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H317-H410 |
|---|
| Precautionary Statements | P273-P280-P501 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S36/37 |
|---|
| RIDADR | UN3077 9/PG 3 |
|---|
| RTECS | NY2390000 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2934999050 |
|---|
Customs
| HS Code | 2934999050 |
|---|
| Summary | 2934999050 ethyl 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
|---|
Synonyms
| 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylic acid ethyl ester |
| isoxadifen-ethyl |
| 3-Isoxazolecarboxylic acid, 4,5-dihydro-5,5-diphenyl-, ethyl ester |
| 4,5-dihydro-5,5-diphenyl-3-isoxazol-carboxylic acid ethyl ester |
| Ethyl 5,5-diphenyl-4,5-dihydroisoxazole-3-carboxylate |
| Ethyl 5,5-diphenyl-2-isoxazoline-3-carboxylate |
| 4,5-Dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylic acid, ethyl ester |
| 4,5-Dihydro-5,5-diphenyl-3-isoxazolecarboxylic acid ethyl ester |
| ethyl 4,5-dihydro-5,5-diphenyl-3-isoxazole-carboxylate |
| Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate |
| ethyl 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylate |
| 4,5-dihydro-5,5-diphenyl-1,2-oxazole-3-carboxylic acid ethyl ester |
| ethyl 5,5-diphenyl-4H-1,2-oxazole-3-carboxylate |
| ethyl 5,5-diphenyl-3-isoxazolinecarboxylate |
| Ethyl 4,5-dihydro-5,5-diphenyl-3-isoxazolecarboxylate |
| T5NO EUTJ CR& CR& EVO2 |
