Introduction：Basic information about CAS 13957-36-3|1,3,5-Triazine-2,4-diamine,N2,N2,N4,N4-tetraethyl-6-hydrazinyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Triazine-2,4-diamine,N2,N2,N4,N4-tetraethyl-6-hydrazinyl- |
|---|
| CAS Number | 13957-36-3 | Molecular Weight | 253.34700 |
|---|
| Density | 1.163g/cm3 | Boiling Point | 422.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H23N7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.2ºC |
|---|
Names
| Name | 2-N,2-N,4-N,4-N-tetraethyl-6-hydrazinyl-1,3,5-triazine-2,4-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.163g/cm3 |
|---|
| Boiling Point | 422.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H23N7 |
|---|
| Molecular Weight | 253.34700 |
|---|
| Flash Point | 209.2ºC |
|---|
| Exact Mass | 253.20100 |
|---|
| PSA | 86.43000 |
|---|
| LogP | 0.97180 |
|---|
| Vapour Pressure | 2.43E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | IRQOBYXMACIFKD-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1nc(NN)nc(N(CC)CC)n1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| tetra-N-ethyl-6-hydrazino-[1,3,5]triazine-2,4-diamine |
| Hydramitrazine |
| 4,6-Bis-diethylamino-2-hydrazino-1,3,5-triazin |
| Lisidonil |
| N2,N2,N4,N4-Tetraaethyl-6-hydrazino-[1,3,5]triazin-2,4-diyldiamin |
| 4,6-bis(diethylamino)-1,3,5-triazin-2(1h)-one hydrazone |
| Meladrazina |
| 2,4-bis(diaethylamino)-6-hydrazino-1,3,5-triazin |
| Meladrazine |
| 2-Hydrazino-4.6-bis-(diethylamino)-1.3.5-triazin |
| Meladrazinum |
