Introduction：Basic information about CAS 132449-46-8|Lesopitron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lesopitron |
|---|
| CAS Number | 132449-46-8 | Molecular Weight | 320.82000 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 504ºC at 760mmHg |
|---|
| Molecular Formula | C15H21ClN6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.6ºC |
|---|
Names
| Name | 2-[4-[4-(4-chloropyrazol-1-yl)butyl]piperazin-1-yl]pyrimidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 504ºC at 760mmHg |
|---|
| Molecular Formula | C15H21ClN6 |
|---|
| Molecular Weight | 320.82000 |
|---|
| Flash Point | 258.6ºC |
|---|
| Exact Mass | 320.15200 |
|---|
| PSA | 50.08000 |
|---|
| LogP | 1.93180 |
|---|
| Vapour Pressure | 2.77E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | AHCPKWJUALHOPH-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cnn(CCCCN2CCN(c3ncccn3)CC2)c1 |
|---|
Synonyms
| UNII-H1CGM4755H |
| lesopitron[inn] |
| Lesopitron |
