Introduction：Basic information about CAS 473-42-7|Nitrosulfathiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nitrosulfathiazole |
|---|
| CAS Number | 473-42-7 | Molecular Weight | 285.30000 |
|---|
| Density | 1.648g/cm3 | Boiling Point | 495ºC at 760mmHg |
|---|
| Molecular Formula | C9H7N3O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.2ºC |
|---|
Names
| Name | 4-nitro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.648g/cm3 |
|---|
| Boiling Point | 495ºC at 760mmHg |
|---|
| Molecular Formula | C9H7N3O4S2 |
|---|
| Molecular Weight | 285.30000 |
|---|
| Flash Point | 253.2ºC |
|---|
| Exact Mass | 284.98800 |
|---|
| PSA | 141.50000 |
|---|
| LogP | 3.52910 |
|---|
| Vapour Pressure | 6.11E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | CIASIHHEOGXVOM-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
|---|
Synonyms
| 4-Nitro-benzolsulfonsaeure-thiazol-2-ylamid |
| p-nitrosulfathiazole |
| 4-nitro-benzenesulfonic acid thiazol-2-ylamide |
| Nitrosulfatiazol |
| Nisulfazole |
| p-Nitro-N-2-thiazolylbenzenesulfonamide |
| Nitrosulfathiazole |
| para-Nitrosulfathiazole |
| Nisulfazol |
| 4-nitro-N-thiazol-2-yl-benzenesulfonamide |
| 2-(4-nitrophenylsulfonamido)thiazole |
