Introduction：Basic information about CAS 63023-95-0|Z-Tyr-Phe-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Tyr-Phe-OH |
|---|
| CAS Number | 63023-95-0 | Molecular Weight | 462.49400 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 780ºC at 760 mmHg |
|---|
| Molecular Formula | C26H26N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 425.5ºC |
|---|
Names
| Name | 2-[[3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 780ºC at 760 mmHg |
|---|
| Molecular Formula | C26H26N2O6 |
|---|
| Molecular Weight | 462.49400 |
|---|
| Flash Point | 425.5ºC |
|---|
| Exact Mass | 462.17900 |
|---|
| PSA | 124.96000 |
|---|
| LogP | 3.82360 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | MSBIPIZMVNYBTJ-GOTSBHOMSA-N |
|---|
| SMILES | O=C(NC(Cc1ccc(O)cc1)C(=O)NC(Cc1ccccc1)C(=O)O)OCc1ccccc1 |
|---|
Synonyms
| Cbz-L-Tyr-L-Phe-OH |
| N-Benzyloxycarbonyl-L-tyrosyl-L-phenylalanin |
| N-Z-L-Tyr-L-Phe |
